C12H10O4 — CID 565624
1,4-bis(furan-2-yl)but-2-yne-1,4-diol (PubChem CID 565624) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 1,4-bis(furan-2-yl)but-2-yne-1,4-diol.
| Compound Name | 1,4-bis(furan-2-yl)but-2-yne-1,4-diol |
|---|---|
| PubChem CID | 565624 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1,4-bis(furan-2-yl)but-2-yne-1,4-diol |
| SMILES | OC(C#CC(O)c1ccco1)c1ccco1 |
| InChI | InChI=1S/C12H10O4/c13-9(11-3-1-7-15-11)5-6-10(14)12-4-2-8-16-12/h1-4,7-10,13-14H |
| InChIKey | MYQSDSIEYSPFJW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|