C14H18N2O2 — CID 97249673
(1S,3R)-1-(furan-2-yl)-3-(pyridin-4-ylmethylamino)butan-1-ol (PubChem CID 97249673) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,3R)-1-(furan-2-yl)-3-(pyridin-4-ylmethylamino)butan-1-ol.
| Compound Name | (1S,3R)-1-(furan-2-yl)-3-(pyridin-4-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 97249673 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1S,3R)-1-(furan-2-yl)-3-(pyridin-4-ylmethylamino)butan-1-ol |
| SMILES | C[C@H](C[C@H](O)c1ccco1)NCc1ccncc1 |
| InChI | InChI=1S/C14H18N2O2/c1-11(9-13(17)14-3-2-8-18-14)16-10-12-4-6-15-7-5-12/h2-8,11,13,16-17H,9-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | MGKAQXSFFUXOMM-YPMHNXCESA-N |
| XLogP | 2.28 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |