C12H18BrNO — CID 79412864
2-(aminomethyl)-1-(3-bromophenyl)pentan-1-ol (PubChem CID 79412864) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(3-bromophenyl)pentan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(3-bromophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 79412864 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(aminomethyl)-1-(3-bromophenyl)pentan-1-ol |
| SMILES | CCCC(CN)C(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H18BrNO/c1-2-4-10(8-14)12(15)9-5-3-6-11(13)7-9/h3,5-7,10,12,15H,2,4,8,14H2,1H3 |
| InChIKey | AOPBHZNKJAJMPS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |