About 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol
2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol (PubChem CID 107955052) has the molecular formula C12H17Br2NO
and a molecular weight of 351.08 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol |
| PubChem CID | 107955052 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol |
| SMILES | CCCC(CN)C(O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H17Br2NO/c1-2-3-8(7-15)12(16)10-5-4-9(13)6-11(10)14/h4-6,8,12,16H,2-3,7,15H2,1H3 |
| InChIKey | QGJFONWSLMDEGM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol?
The IUPAC name of 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol (CID 107955052) is 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol.
What is the SMILES notation for 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol?
The canonical SMILES for 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol is CCCC(CN)C(O)c1ccc(Br)cc1Br.
What is the InChIKey of 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol?
The InChIKey is QGJFONWSLMDEGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br2NO/c1-2-3-8(7-15)12(16)10-5-4-9(13)6-11(10)14/h4-6,8,12,16H,2-3,7,15H2,1H3.
What are the key properties of 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol?
2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol has a molecular weight of 351.08 g/mol, XLogP of 3.62, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1-(2,4-dibromophenyl)pentan-1-ol is sourced from PubChem (CID 107955052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).