C14H19Br3 — CID 82988110
1,4-dibromo-2-(1-bromo-2-propylpentyl)benzene (PubChem CID 82988110) has the molecular formula C14H19Br3 and a molecular weight of 427.02 g/mol. Its IUPAC name is 1,4-dibromo-2-(1-bromo-2-propylpentyl)benzene.
| Compound Name | 1,4-dibromo-2-(1-bromo-2-propylpentyl)benzene |
|---|---|
| PubChem CID | 82988110 |
| Molecular Formula | C14H19Br3 |
| Molecular Weight | 427.02 g/mol |
| Exact Mass | 423.90 |
| IUPAC Name | 1,4-dibromo-2-(1-bromo-2-propylpentyl)benzene |
| SMILES | CCCC(CCC)C(Br)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H19Br3/c1-3-5-10(6-4-2)14(17)12-9-11(15)7-8-13(12)16/h7-10,14H,3-6H2,1-2H3 |
| InChIKey | XKQPWXGPEBJUED-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.02 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|