C11H14Br2O — CID 61100587
1-(2,5-dibromophenyl)-3-methylbutan-1-ol (PubChem CID 61100587) has the molecular formula C11H14Br2O and a molecular weight of 322.04 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-3-methylbutan-1-ol.
| Compound Name | 1-(2,5-dibromophenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 61100587 |
| Molecular Formula | C11H14Br2O |
| Molecular Weight | 322.04 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 1-(2,5-dibromophenyl)-3-methylbutan-1-ol |
| SMILES | CC(C)CC(O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2O/c1-7(2)5-11(14)9-6-8(12)3-4-10(9)13/h3-4,6-7,11,14H,5H2,1-2H3 |
| InChIKey | DOGLSUAHNGZSPU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.04 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |