C11H12Br2F2O2 — CID 103210074
1-(2,5-dibromophenyl)-3-(2,2-difluoroethoxy)propan-1-ol (PubChem CID 103210074) has the molecular formula C11H12Br2F2O2 and a molecular weight of 374.02 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-3-(2,2-difluoroethoxy)propan-1-ol.
| Compound Name | 1-(2,5-dibromophenyl)-3-(2,2-difluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103210074 |
| Molecular Formula | C11H12Br2F2O2 |
| Molecular Weight | 374.02 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | 1-(2,5-dibromophenyl)-3-(2,2-difluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H12Br2F2O2/c12-7-1-2-9(13)8(5-7)10(16)3-4-17-6-11(14)15/h1-2,5,10-11,16H,3-4,6H2 |
| InChIKey | QVKLGRZMTNMDSN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.02 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|