C11H12F5NO2 — CID 103147785
3-(2,2-difluoroethoxy)-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-ol (PubChem CID 103147785) has the molecular formula C11H12F5NO2 and a molecular weight of 285.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 103147785 |
| Molecular Formula | C11H12F5NO2 |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-[4-(trifluoromethyl)-3-pyridinyl]propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C11H12F5NO2/c12-10(13)6-19-4-2-9(18)7-5-17-3-1-8(7)11(14,15)16/h1,3,5,9-10,18H,2,4,6H2 |
| InChIKey | MBKMSBNXNJWUNE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|