C12H14BrF3O2 — CID 103147832
1-(3-bromo-5-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-ol (PubChem CID 103147832) has the molecular formula C12H14BrF3O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-ol.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-ol |
|---|---|
| PubChem CID | 103147832 |
| Molecular Formula | C12H14BrF3O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-4-(2,2-difluoroethoxy)butan-2-ol |
| SMILES | OC(CCOCC(F)F)Cc1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C12H14BrF3O2/c13-9-3-8(4-10(14)6-9)5-11(17)1-2-18-7-12(15)16/h3-4,6,11-12,17H,1-2,5,7H2 |
| InChIKey | UQIKJDUIDCBYTF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|