C13H15BrF2O3 — CID 103210444
1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-3-(2,2-difluoroethoxy)propan-1-ol (PubChem CID 103210444) has the molecular formula C13H15BrF2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-3-(2,2-difluoroethoxy)propan-1-ol.
| Compound Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-3-(2,2-difluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 103210444 |
| Molecular Formula | C13H15BrF2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 1-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-3-(2,2-difluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H15BrF2O3/c14-9-5-8-1-4-19-13(8)10(6-9)11(17)2-3-18-7-12(15)16/h5-6,11-12,17H,1-4,7H2 |
| InChIKey | AQSYHDQGTRAAPL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|