C11H13BrO — CID 59446392
5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran (PubChem CID 59446392) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 59446392 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran |
| SMILES | CC(C)c1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C11H13BrO/c1-7(2)10-6-9(12)5-8-3-4-13-11(8)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | LYCHBJRFDGXSES-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |