C18H18Br2O — CID 104543584
5-bromo-7-[bromo-(2,4,6-trimethylphenyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 104543584) has the molecular formula C18H18Br2O and a molecular weight of 410.15 g/mol. Its IUPAC name is 5-bromo-7-[bromo-(2,4,6-trimethylphenyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[bromo-(2,4,6-trimethylphenyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543584 |
| Molecular Formula | C18H18Br2O |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 5-bromo-7-[bromo-(2,4,6-trimethylphenyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Cc1cc(C)c(C(Br)c2cc(Br)cc3c2OCC3)c(C)c1 |
| InChI | InChI=1S/C18H18Br2O/c1-10-6-11(2)16(12(3)7-10)17(20)15-9-14(19)8-13-4-5-21-18(13)15/h6-9,17H,4-5H2,1-3H3 |
| InChIKey | UKQSDEAVIZLLHH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|