C13H9Br3OS — CID 104543607
5-bromo-7-[bromo-(3-bromothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 104543607) has the molecular formula C13H9Br3OS and a molecular weight of 452.99 g/mol. Its IUPAC name is 5-bromo-7-[bromo-(3-bromothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[bromo-(3-bromothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543607 |
| Molecular Formula | C13H9Br3OS |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 449.79 |
| IUPAC Name | 5-bromo-7-[bromo-(3-bromothiophen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Brc1cc2c(c(C(Br)c3sccc3Br)c1)OCC2 |
| InChI | InChI=1S/C13H9Br3OS/c14-8-5-7-1-3-17-12(7)9(6-8)11(16)13-10(15)2-4-18-13/h2,4-6,11H,1,3H2 |
| InChIKey | IZCLTSLOYRFVIS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|