C13H10BrIO2S — CID 114279846
(3-bromothiophen-2-yl)-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)methanol (PubChem CID 114279846) has the molecular formula C13H10BrIO2S and a molecular weight of 437.10 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)methanol.
| Compound Name | (3-bromothiophen-2-yl)-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)methanol |
|---|---|
| PubChem CID | 114279846 |
| Molecular Formula | C13H10BrIO2S |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 435.86 |
| IUPAC Name | (3-bromothiophen-2-yl)-(5-iodo-2,3-dihydro-1-benzofuran-7-yl)methanol |
| SMILES | OC(c1cc(I)cc2c1OCC2)c1sccc1Br |
| InChI | InChI=1S/C13H10BrIO2S/c14-10-2-4-18-13(10)11(16)9-6-8(15)5-7-1-3-17-12(7)9/h2,4-6,11,16H,1,3H2 |
| InChIKey | KBIHBWFJMMOHIV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|