C13H8BrCl2IOS — CID 114279880
7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-5-iodo-2,3-dihydro-1-benzofuran (PubChem CID 114279880) has the molecular formula C13H8BrCl2IOS and a molecular weight of 489.99 g/mol. Its IUPAC name is 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-5-iodo-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-5-iodo-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 114279880 |
| Molecular Formula | C13H8BrCl2IOS |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 487.79 |
| IUPAC Name | 7-[bromo-(2,5-dichlorothiophen-3-yl)methyl]-5-iodo-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cc(C(Br)c2cc(I)cc3c2OCC3)c(Cl)s1 |
| InChI | InChI=1S/C13H8BrCl2IOS/c14-11(9-5-10(15)19-13(9)16)8-4-7(17)3-6-1-2-18-12(6)8/h3-5,11H,1-2H2 |
| InChIKey | BJNQKRXPFQQDTL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|