C15H10BrCl2FO — CID 104543989
7-[bromo-(2-chloro-4-fluorophenyl)methyl]-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 104543989) has the molecular formula C15H10BrCl2FO and a molecular weight of 376.05 g/mol. Its IUPAC name is 7-[bromo-(2-chloro-4-fluorophenyl)methyl]-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[bromo-(2-chloro-4-fluorophenyl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543989 |
| Molecular Formula | C15H10BrCl2FO |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 7-[bromo-(2-chloro-4-fluorophenyl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | Fc1ccc(C(Br)c2cc(Cl)cc3c2OCC3)c(Cl)c1 |
| InChI | InChI=1S/C15H10BrCl2FO/c16-14(11-2-1-10(19)7-13(11)18)12-6-9(17)5-8-3-4-20-15(8)12/h1-2,5-7,14H,3-4H2 |
| InChIKey | UAMPUYGSCUOSRU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|