C13H10BrClOS — CID 104544052
7-[bromo(thiophen-2-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 104544052) has the molecular formula C13H10BrClOS and a molecular weight of 329.65 g/mol. Its IUPAC name is 7-[bromo(thiophen-2-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[bromo(thiophen-2-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104544052 |
| Molecular Formula | C13H10BrClOS |
| Molecular Weight | 329.65 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 7-[bromo(thiophen-2-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cc2c(c(C(Br)c3cccs3)c1)OCC2 |
| InChI | InChI=1S/C13H10BrClOS/c14-12(11-2-1-5-17-11)10-7-9(15)6-8-3-4-16-13(8)10/h1-2,5-7,12H,3-4H2 |
| InChIKey | BKZGDQSCUQEZAH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|