C15H16BrClO — CID 113425278
7-[3-bicyclo[3.1.0]hexanyl(bromo)methyl]-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 113425278) has the molecular formula C15H16BrClO and a molecular weight of 327.65 g/mol. Its IUPAC name is 7-[3-bicyclo[3.1.0]hexanyl(bromo)methyl]-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[3-bicyclo[3.1.0]hexanyl(bromo)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 113425278 |
| Molecular Formula | C15H16BrClO |
| Molecular Weight | 327.65 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 7-[3-bicyclo[3.1.0]hexanyl(bromo)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cc2c(c(C(Br)C3CC4CC4C3)c1)OCC2 |
| InChI | InChI=1S/C15H16BrClO/c16-14(11-4-9-3-10(9)5-11)13-7-12(17)6-8-1-2-18-15(8)13/h6-7,9-11,14H,1-5H2 |
| InChIKey | XDVGBJNJSPSYGH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|