C16H20BrClO2 — CID 104543957
7-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran (PubChem CID 104543957) has the molecular formula C16H20BrClO2 and a molecular weight of 359.69 g/mol. Its IUPAC name is 7-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 104543957 |
| Molecular Formula | C16H20BrClO2 |
| Molecular Weight | 359.69 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 7-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-5-chloro-2,3-dihydro-1-benzofuran |
| SMILES | CC1OC(C)C(C(Br)c2cc(Cl)cc3c2OCC3)C1C |
| InChI | InChI=1S/C16H20BrClO2/c1-8-9(2)20-10(3)14(8)15(17)13-7-12(18)6-11-4-5-19-16(11)13/h6-10,14-15H,4-5H2,1-3H3 |
| InChIKey | MMJXLMOQRHTFKW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|