C15H20BrClO2 — CID 104546511
3-[bromo-(5-chloro-2-methoxyphenyl)methyl]-2,4,5-trimethyloxolane (PubChem CID 104546511) has the molecular formula C15H20BrClO2 and a molecular weight of 347.68 g/mol. Its IUPAC name is 3-[bromo-(5-chloro-2-methoxyphenyl)methyl]-2,4,5-trimethyloxolane.
| Compound Name | 3-[bromo-(5-chloro-2-methoxyphenyl)methyl]-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 104546511 |
| Molecular Formula | C15H20BrClO2 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-[bromo-(5-chloro-2-methoxyphenyl)methyl]-2,4,5-trimethyloxolane |
| SMILES | COc1ccc(Cl)cc1C(Br)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C15H20BrClO2/c1-8-9(2)19-10(3)14(8)15(16)12-7-11(17)5-6-13(12)18-4/h5-10,14-15H,1-4H3 |
| InChIKey | DZYXXQOAPLXMJT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|