C15H19BrClFO — CID 81050749
3-[bromo-(2-chloro-4-fluoro-5-methylphenyl)methyl]-2,4,5-trimethyloxolane (PubChem CID 81050749) has the molecular formula C15H19BrClFO and a molecular weight of 349.67 g/mol. Its IUPAC name is 3-[bromo-(2-chloro-4-fluoro-5-methylphenyl)methyl]-2,4,5-trimethyloxolane.
| Compound Name | 3-[bromo-(2-chloro-4-fluoro-5-methylphenyl)methyl]-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 81050749 |
| Molecular Formula | C15H19BrClFO |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-[bromo-(2-chloro-4-fluoro-5-methylphenyl)methyl]-2,4,5-trimethyloxolane |
| SMILES | Cc1cc(C(Br)C2C(C)OC(C)C2C)c(Cl)cc1F |
| InChI | InChI=1S/C15H19BrClFO/c1-7-5-11(12(17)6-13(7)18)15(16)14-8(2)9(3)19-10(14)4/h5-6,8-10,14-15H,1-4H3 |
| InChIKey | MZYOASCUIYLABB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|