C15H20ClFO — CID 79746653
3-[chloro-(4-fluoro-3-methylphenyl)methyl]-2,4,5-trimethyloxolane (PubChem CID 79746653) has the molecular formula C15H20ClFO and a molecular weight of 270.77 g/mol. Its IUPAC name is 3-[chloro-(4-fluoro-3-methylphenyl)methyl]-2,4,5-trimethyloxolane.
| Compound Name | 3-[chloro-(4-fluoro-3-methylphenyl)methyl]-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 79746653 |
| Molecular Formula | C15H20ClFO |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[chloro-(4-fluoro-3-methylphenyl)methyl]-2,4,5-trimethyloxolane |
| SMILES | Cc1cc(C(Cl)C2C(C)OC(C)C2C)ccc1F |
| InChI | InChI=1S/C15H20ClFO/c1-8-7-12(5-6-13(8)17)15(16)14-9(2)10(3)18-11(14)4/h5-7,9-11,14-15H,1-4H3 |
| InChIKey | XGISZSDXGROWMZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|