C18H27ClO — CID 65158343
3-[chloro-[4-(2-methylpropyl)phenyl]methyl]-2,4,5-trimethyloxolane (PubChem CID 65158343) has the molecular formula C18H27ClO and a molecular weight of 294.87 g/mol. Its IUPAC name is 3-[chloro-[4-(2-methylpropyl)phenyl]methyl]-2,4,5-trimethyloxolane.
| Compound Name | 3-[chloro-[4-(2-methylpropyl)phenyl]methyl]-2,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 65158343 |
| Molecular Formula | C18H27ClO |
| Molecular Weight | 294.87 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-[chloro-[4-(2-methylpropyl)phenyl]methyl]-2,4,5-trimethyloxolane |
| SMILES | CC(C)Cc1ccc(C(Cl)C2C(C)OC(C)C2C)cc1 |
| InChI | InChI=1S/C18H27ClO/c1-11(2)10-15-6-8-16(9-7-15)18(19)17-12(3)13(4)20-14(17)5/h6-9,11-14,17-18H,10H2,1-5H3 |
| InChIKey | RVQXWSLKIHZKIV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.87 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|