C19H29Cl — CID 107181911
1-[chloro-(2,2-dimethylcyclohexyl)methyl]-4-(2-methylpropyl)benzene (PubChem CID 107181911) has the molecular formula C19H29Cl and a molecular weight of 292.89 g/mol. Its IUPAC name is 1-[chloro-(2,2-dimethylcyclohexyl)methyl]-4-(2-methylpropyl)benzene.
| Compound Name | 1-[chloro-(2,2-dimethylcyclohexyl)methyl]-4-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 107181911 |
| Molecular Formula | C19H29Cl |
| Molecular Weight | 292.89 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-[chloro-(2,2-dimethylcyclohexyl)methyl]-4-(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1ccc(C(Cl)C2CCCCC2(C)C)cc1 |
| InChI | InChI=1S/C19H29Cl/c1-14(2)13-15-8-10-16(11-9-15)18(20)17-7-5-6-12-19(17,3)4/h8-11,14,17-18H,5-7,12-13H2,1-4H3 |
| InChIKey | WECUZGZXMCJXJD-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|