C17H23ClO — CID 107181961
5-[chloro-(2,2-dimethylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 107181961) has the molecular formula C17H23ClO and a molecular weight of 278.82 g/mol. Its IUPAC name is 5-[chloro-(2,2-dimethylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro-(2,2-dimethylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 107181961 |
| Molecular Formula | C17H23ClO |
| Molecular Weight | 278.82 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-[chloro-(2,2-dimethylcyclohexyl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | CC1(C)CCCCC1C(Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H23ClO/c1-17(2)9-4-3-5-14(17)16(18)13-6-7-15-12(11-13)8-10-19-15/h6-7,11,14,16H,3-5,8-10H2,1-2H3 |
| InChIKey | PQMYTXJWNJELAC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.82 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|