C19H19ClO — CID 107127425
5-[chloro(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 107127425) has the molecular formula C19H19ClO and a molecular weight of 298.81 g/mol. Its IUPAC name is 5-[chloro(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[chloro(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 107127425 |
| Molecular Formula | C19H19ClO |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-[chloro(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | ClC(c1ccc2c(c1)CCO2)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H19ClO/c20-19(17-7-8-18-15(12-17)9-10-21-18)16-6-5-13-3-1-2-4-14(13)11-16/h1-4,7-8,12,16,19H,5-6,9-11H2 |
| InChIKey | JVKNOTMLVFFQFE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|