C17H15ClO2 — CID 61086355
2-[chloro(2,3-dihydro-1-benzofuran-5-yl)methyl]-2,3-dihydro-1-benzofuran (PubChem CID 61086355) has the molecular formula C17H15ClO2 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2-[chloro(2,3-dihydro-1-benzofuran-5-yl)methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 2-[chloro(2,3-dihydro-1-benzofuran-5-yl)methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 61086355 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[chloro(2,3-dihydro-1-benzofuran-5-yl)methyl]-2,3-dihydro-1-benzofuran |
| SMILES | ClC(c1ccc2c(c1)CCO2)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C17H15ClO2/c18-17(13-5-6-14-12(9-13)7-8-19-14)16-10-11-3-1-2-4-15(11)20-16/h1-6,9,16-17H,7-8,10H2 |
| InChIKey | VUXSDRPBQMINSY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|