C17H18N2O — CID 105224868
[7-bicyclo[4.2.0]octa-1,3,5-trienyl(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine (PubChem CID 105224868) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is [7-bicyclo[4.2.0]octa-1,3,5-trienyl(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine.
| Compound Name | [7-bicyclo[4.2.0]octa-1,3,5-trienyl(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105224868 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [7-bicyclo[4.2.0]octa-1,3,5-trienyl(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)C1Cc2ccccc21 |
| InChI | InChI=1S/C17H18N2O/c18-19-17(15-10-11-3-1-2-4-14(11)15)13-5-6-16-12(9-13)7-8-20-16/h1-6,9,15,17,19H,7-8,10,18H2 |
| InChIKey | BXCHZNJJLUFRAI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|