C15H15ClN2O — CID 105211193
[(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine (PubChem CID 105211193) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is [(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine.
| Compound Name | [(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105211193 |
| Molecular Formula | C15H15ClN2O |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)c1ccccc1Cl |
| InChI | InChI=1S/C15H15ClN2O/c16-13-4-2-1-3-12(13)15(18-17)11-5-6-14-10(9-11)7-8-19-14/h1-6,9,15,18H,7-8,17H2 |
| InChIKey | IGGJTEIBQKHKLS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|