C15H14Br2N2O — CID 107948484
[(2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine (PubChem CID 107948484) has the molecular formula C15H14Br2N2O and a molecular weight of 398.10 g/mol. Its IUPAC name is [(2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine.
| Compound Name | [(2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107948484 |
| Molecular Formula | C15H14Br2N2O |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | [(2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H14Br2N2O/c16-11-2-3-12(13(17)8-11)15(19-18)10-1-4-14-9(7-10)5-6-20-14/h1-4,7-8,15,19H,5-6,18H2 |
| InChIKey | FPJSUSJJSTVORT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|