C13H13ClN2O2 — CID 106694707
[(2-chlorofuran-3-yl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine (PubChem CID 106694707) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is [(2-chlorofuran-3-yl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine.
| Compound Name | [(2-chlorofuran-3-yl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106694707 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | [(2-chlorofuran-3-yl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)c1ccoc1Cl |
| InChI | InChI=1S/C13H13ClN2O2/c14-13-10(4-6-18-13)12(16-15)9-1-2-11-8(7-9)3-5-17-11/h1-2,4,6-7,12,16H,3,5,15H2 |
| InChIKey | RQKWBEHMNHKZRQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|