C15H14F2N2O — CID 105219495
[(2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine (PubChem CID 105219495) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is [(2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine.
| Compound Name | [(2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105219495 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ccc2c(c1)CCO2)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H14F2N2O/c16-11-2-3-13(17)12(8-11)15(19-18)10-1-4-14-9(7-10)5-6-20-14/h1-4,7-8,15,19H,5-6,18H2 |
| InChIKey | PJSNHZBXEMYVDQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|