C16H14Br2O2 — CID 107955593
(2,4-dibromophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanol (PubChem CID 107955593) has the molecular formula C16H14Br2O2 and a molecular weight of 398.09 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanol.
| Compound Name | (2,4-dibromophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanol |
|---|---|
| PubChem CID | 107955593 |
| Molecular Formula | C16H14Br2O2 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | (2,4-dibromophenyl)-(3,4-dihydro-2H-chromen-6-yl)methanol |
| SMILES | OC(c1ccc2c(c1)CCCO2)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H14Br2O2/c17-12-4-5-13(14(18)9-12)16(19)11-3-6-15-10(8-11)2-1-7-20-15/h3-6,8-9,16,19H,1-2,7H2 |
| InChIKey | QQSXUMJVTJVXBP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |