C16H13F3O2 — CID 79756720
3,4-dihydro-2H-chromen-6-yl-(2,3,4-trifluorophenyl)methanol (PubChem CID 79756720) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(2,3,4-trifluorophenyl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 79756720 |
| Molecular Formula | C16H13F3O2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc2c(c1)CCCO2)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H13F3O2/c17-12-5-4-11(14(18)15(12)19)16(20)10-3-6-13-9(8-10)2-1-7-21-13/h3-6,8,16,20H,1-2,7H2 |
| InChIKey | HFIHFXUPRZSMLK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|