C15H11BrF2O2 — CID 107538465
(2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol (PubChem CID 107538465) has the molecular formula C15H11BrF2O2 and a molecular weight of 341.15 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol |
|---|---|
| PubChem CID | 107538465 |
| Molecular Formula | C15H11BrF2O2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanol |
| SMILES | OC(c1ccc2c(c1)CCO2)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H11BrF2O2/c16-13-10(2-3-11(17)14(13)18)15(19)9-1-4-12-8(7-9)5-6-20-12/h1-4,7,15,19H,5-6H2 |
| InChIKey | GTQJERYELUXXOI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|