C15H12BrF2NO2 — CID 107538576
(2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine (PubChem CID 107538576) has the molecular formula C15H12BrF2NO2 and a molecular weight of 356.17 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
|---|---|
| PubChem CID | 107538576 |
| Molecular Formula | C15H12BrF2NO2 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)OCCO2)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C15H12BrF2NO2/c16-13-9(2-3-10(17)14(13)18)15(19)8-1-4-11-12(7-8)21-6-5-20-11/h1-4,7,15H,5-6,19H2 |
| InChIKey | ZQQYKEUNVTUCIM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|