C17H18BrF2N — CID 107538899
(2-bromo-3,4-difluorophenyl)-(4-tert-butylphenyl)methanamine (PubChem CID 107538899) has the molecular formula C17H18BrF2N and a molecular weight of 354.24 g/mol. Its IUPAC name is (2-bromo-3,4-difluorophenyl)-(4-tert-butylphenyl)methanamine.
| Compound Name | (2-bromo-3,4-difluorophenyl)-(4-tert-butylphenyl)methanamine |
|---|---|
| PubChem CID | 107538899 |
| Molecular Formula | C17H18BrF2N |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (2-bromo-3,4-difluorophenyl)-(4-tert-butylphenyl)methanamine |
| SMILES | CC(C)(C)c1ccc(C(N)c2ccc(F)c(F)c2Br)cc1 |
| InChI | InChI=1S/C17H18BrF2N/c1-17(2,3)11-6-4-10(5-7-11)16(21)12-8-9-13(19)15(20)14(12)18/h4-9,16H,21H2,1-3H3 |
| InChIKey | IWVDUOOEDIZSAF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|