C8H8BrF2N — CID 103739050
(1S)-1-(2-bromo-3,4-difluorophenyl)ethanamine (PubChem CID 103739050) has the molecular formula C8H8BrF2N and a molecular weight of 236.06 g/mol. Its IUPAC name is (1S)-1-(2-bromo-3,4-difluorophenyl)ethanamine.
| Compound Name | (1S)-1-(2-bromo-3,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 103739050 |
| Molecular Formula | C8H8BrF2N |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | (1S)-1-(2-bromo-3,4-difluorophenyl)ethanamine |
| SMILES | C[C@H](N)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C8H8BrF2N/c1-4(12)5-2-3-6(10)8(11)7(5)9/h2-4H,12H2,1H3/t4-/m0/s1 |
| InChIKey | HQZCRBKPCBMDBV-BYPYZUCNSA-N |
| XLogP | 2.75 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|