C9H10BrF2N — CID 130658227
(2S)-1-(2-bromo-3,4-difluorophenyl)propan-2-amine (PubChem CID 130658227) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is (2S)-1-(2-bromo-3,4-difluorophenyl)propan-2-amine.
| Compound Name | (2S)-1-(2-bromo-3,4-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 130658227 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (2S)-1-(2-bromo-3,4-difluorophenyl)propan-2-amine |
| SMILES | C[C@H](N)Cc1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C9H10BrF2N/c1-5(13)4-6-2-3-7(11)9(12)8(6)10/h2-3,5H,4,13H2,1H3/t5-/m0/s1 |
| InChIKey | NVQRKUPPWOAFMO-YFKPBYRVSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|