C17H18O2 — CID 61080777
3,4-dihydro-2H-chromen-6-yl-(2-methylphenyl)methanol (PubChem CID 61080777) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(2-methylphenyl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(2-methylphenyl)methanol |
|---|---|
| PubChem CID | 61080777 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(2-methylphenyl)methanol |
| SMILES | Cc1ccccc1C(O)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C17H18O2/c1-12-5-2-3-7-15(12)17(18)14-8-9-16-13(11-14)6-4-10-19-16/h2-3,5,7-9,11,17-18H,4,6,10H2,1H3 |
| InChIKey | PHFVGAYOFYWHAD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |