C19H22O2 — CID 62538318
1-(3,4-dihydro-2H-chromen-6-yl)-2-(3,4-dimethylphenyl)ethanol (PubChem CID 62538318) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-6-yl)-2-(3,4-dimethylphenyl)ethanol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-6-yl)-2-(3,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 62538318 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-6-yl)-2-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(CC(O)c2ccc3c(c2)CCCO3)cc1C |
| InChI | InChI=1S/C19H22O2/c1-13-5-6-15(10-14(13)2)11-18(20)16-7-8-19-17(12-16)4-3-9-21-19/h5-8,10,12,18,20H,3-4,9,11H2,1-2H3 |
| InChIKey | IXRMMBFQHGOLRA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |