C12H17NO2 — CID 82241510
2-amino-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanol (PubChem CID 82241510) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-amino-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanol.
| Compound Name | 2-amino-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanol |
|---|---|
| PubChem CID | 82241510 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-amino-1-(2,3,4,5-tetrahydro-1-benzoxepin-7-yl)ethanol |
| SMILES | NCC(O)c1ccc2c(c1)CCCCO2 |
| InChI | InChI=1S/C12H17NO2/c13-8-11(14)9-4-5-12-10(7-9)3-1-2-6-15-12/h4-5,7,11,14H,1-3,6,8,13H2 |
| InChIKey | RDRZKDVDRYDPDW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |