C11H15NO — CID 83001263
(1S)-2-amino-1-(2,3-dihydro-1H-inden-5-yl)ethanol (PubChem CID 83001263) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (1S)-2-amino-1-(2,3-dihydro-1H-inden-5-yl)ethanol.
| Compound Name | (1S)-2-amino-1-(2,3-dihydro-1H-inden-5-yl)ethanol |
|---|---|
| PubChem CID | 83001263 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (1S)-2-amino-1-(2,3-dihydro-1H-inden-5-yl)ethanol |
| SMILES | NC[C@@H](O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H15NO/c12-7-11(13)10-5-4-8-2-1-3-9(8)6-10/h4-6,11,13H,1-3,7,12H2/t11-/m1/s1 |
| InChIKey | IDFAEJQKQCDPLU-LLVKDONJSA-N |
| XLogP | 1.17 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |