C10H14N2 — CID 116939135
2,3-dihydro-1H-inden-5-ylmethanediamine (PubChem CID 116939135) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-ylmethanediamine.
| Compound Name | 2,3-dihydro-1H-inden-5-ylmethanediamine |
|---|---|
| PubChem CID | 116939135 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-ylmethanediamine |
| SMILES | NC(N)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H14N2/c11-10(12)9-5-4-7-2-1-3-8(7)6-9/h4-6,10H,1-3,11-12H2 |
| InChIKey | IBLOMOXWLVLRLH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|