C16H15F2N — CID 43115569
(2,6-difluorophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine (PubChem CID 43115569) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine.
| Compound Name | (2,6-difluorophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine |
|---|---|
| PubChem CID | 43115569 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2,6-difluorophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)CCC2)c1c(F)cccc1F |
| InChI | InChI=1S/C16H15F2N/c17-13-5-2-6-14(18)15(13)16(19)12-8-7-10-3-1-4-11(10)9-12/h2,5-9,16H,1,3-4,19H2 |
| InChIKey | MBXURDAPWKWNDO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |