C19H23N — CID 43115552
2,3-dihydro-1H-inden-5-yl-(4-propan-2-ylphenyl)methanamine (PubChem CID 43115552) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(4-propan-2-ylphenyl)methanamine.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(4-propan-2-ylphenyl)methanamine |
|---|---|
| PubChem CID | 43115552 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(4-propan-2-ylphenyl)methanamine |
| SMILES | CC(C)c1ccc(C(N)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H23N/c1-13(2)14-6-9-16(10-7-14)19(20)18-11-8-15-4-3-5-17(15)12-18/h6-13,19H,3-5,20H2,1-2H3 |
| InChIKey | RVQLIJCXDNQGPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |