C16H16BrN — CID 43115600
(2-bromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine (PubChem CID 43115600) has the molecular formula C16H16BrN and a molecular weight of 302.21 g/mol. Its IUPAC name is (2-bromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine.
| Compound Name | (2-bromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine |
|---|---|
| PubChem CID | 43115600 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (2-bromophenyl)-(2,3-dihydro-1H-inden-5-yl)methanamine |
| SMILES | NC(c1ccc2c(c1)CCC2)c1ccccc1Br |
| InChI | InChI=1S/C16H16BrN/c17-15-7-2-1-6-14(15)16(18)13-9-8-11-4-3-5-12(11)10-13/h1-2,6-10,16H,3-5,18H2 |
| InChIKey | AXICJDCVGGOZSE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |