About 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine
1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine (PubChem CID 146221659) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine.
Analyze 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine?
The IUPAC name of 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine (CID 146221659) is 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine.
What is the SMILES notation for 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine?
The canonical SMILES for 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine is CC(N)c1ccc2c(c1)CC2.
What is the InChIKey of 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine?
The InChIKey is YXBZFFMRSJXQDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7(11)9-4-2-8-3-5-10(8)6-9/h2,4,6-7H,3,5,11H2,1H3.
What are the key properties of 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine?
1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine has a molecular weight of 147.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)ethanamine is sourced from PubChem (CID 146221659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).