C9H10O2 — CID 174827553
3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethanediol (PubChem CID 174827553) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethanediol.
| Compound Name | 3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethanediol |
|---|---|
| PubChem CID | 174827553 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethanediol |
| SMILES | OC(O)c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C9H10O2/c10-9(11)8-4-2-6-1-3-7(6)5-8/h2,4-5,9-11H,1,3H2 |
| InChIKey | ZSAYJYRKYVXBNX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|