C13H18OS — CID 116830936
3-sulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-ol (PubChem CID 116830936) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 3-sulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-ol.
| Compound Name | 3-sulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 116830936 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-sulfanyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-ol |
| SMILES | OC(CCS)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H18OS/c14-13(7-8-15)12-6-5-10-3-1-2-4-11(10)9-12/h5-6,9,13-15H,1-4,7-8H2 |
| InChIKey | DGORHGXYFAABIS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|